About methyl 2-hydroxyiminopropanoate
methyl 2-hydroxyiminopropanoate (PubChem CID 71435832) has the molecular formula C4H7NO3
and a molecular weight of 117.10 g/mol. Its IUPAC name is methyl 2-hydroxyiminopropanoate.
Molecular Properties
| Compound Name | methyl 2-hydroxyiminopropanoate |
| PubChem CID | 71435832 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | methyl 2-hydroxyiminopropanoate |
| SMILES | COC(=O)C(C)=NO |
| InChI | InChI=1S/C4H7NO3/c1-3(5-7)4(6)8-2/h7H,1-2H3 |
| InChIKey | GXUGQCNCLMAZCH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxyiminopropanoate?
The IUPAC name of methyl 2-hydroxyiminopropanoate (CID 71435832) is methyl 2-hydroxyiminopropanoate.
What is the SMILES notation for methyl 2-hydroxyiminopropanoate?
The canonical SMILES for methyl 2-hydroxyiminopropanoate is COC(=O)C(C)=NO.
What is the InChIKey of methyl 2-hydroxyiminopropanoate?
The InChIKey is GXUGQCNCLMAZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3/c1-3(5-7)4(6)8-2/h7H,1-2H3.
What are the key properties of methyl 2-hydroxyiminopropanoate?
methyl 2-hydroxyiminopropanoate has a molecular weight of 117.10 g/mol, XLogP of 0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxyiminopropanoate is sourced from PubChem (CID 71435832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).