About methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate
methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate (PubChem CID 71435944) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate |
| PubChem CID | 71435944 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate |
| SMILES | COC(=O)N1C=CC2CC2C=C1 |
| InChI | InChI=1S/C9H11NO2/c1-12-9(11)10-4-2-7-6-8(7)3-5-10/h2-5,7-8H,6H2,1H3 |
| InChIKey | PRCIWAGSOPOLMR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate?
The IUPAC name of methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate (CID 71435944) is methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate.
What is the SMILES notation for methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate?
The canonical SMILES for methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate is COC(=O)N1C=CC2CC2C=C1.
What is the InChIKey of methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate?
The InChIKey is PRCIWAGSOPOLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-12-9(11)10-4-2-7-6-8(7)3-5-10/h2-5,7-8H,6H2,1H3.
What are the key properties of methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate?
methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate has a molecular weight of 165.19 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-azabicyclo[5.1.0]octa-2,5-diene-4-carboxylate is sourced from PubChem (CID 71435944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).