About 6-hydroxy-1,2,3,6-tetrahydroindol-5-one
6-hydroxy-1,2,3,6-tetrahydroindol-5-one (PubChem CID 71435951) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 6-hydroxy-1,2,3,6-tetrahydroindol-5-one.
Molecular Properties
| Compound Name | 6-hydroxy-1,2,3,6-tetrahydroindol-5-one |
| PubChem CID | 71435951 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 6-hydroxy-1,2,3,6-tetrahydroindol-5-one |
| SMILES | O=C1C=C2CCNC2=CC1O |
| InChI | InChI=1S/C8H9NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h3-4,8-9,11H,1-2H2 |
| InChIKey | QWGLSKLPUBNAGC-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-hydroxy-1,2,3,6-tetrahydroindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,2,3,6-tetrahydroindol-5-one?
The IUPAC name of 6-hydroxy-1,2,3,6-tetrahydroindol-5-one (CID 71435951) is 6-hydroxy-1,2,3,6-tetrahydroindol-5-one.
What is the SMILES notation for 6-hydroxy-1,2,3,6-tetrahydroindol-5-one?
The canonical SMILES for 6-hydroxy-1,2,3,6-tetrahydroindol-5-one is O=C1C=C2CCNC2=CC1O.
What is the InChIKey of 6-hydroxy-1,2,3,6-tetrahydroindol-5-one?
The InChIKey is QWGLSKLPUBNAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h3-4,8-9,11H,1-2H2.
What are the key properties of 6-hydroxy-1,2,3,6-tetrahydroindol-5-one?
6-hydroxy-1,2,3,6-tetrahydroindol-5-one has a molecular weight of 151.16 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,2,3,6-tetrahydroindol-5-one is sourced from PubChem (CID 71435951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).