C9H12O3 — CID 71436491
5-acetyl-2,4-dimethyl-2,3-dihydropyran-6-one (PubChem CID 71436491) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 5-acetyl-2,4-dimethyl-2,3-dihydropyran-6-one.
| Compound Name | 5-acetyl-2,4-dimethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 71436491 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5-acetyl-2,4-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CC(=O)C1=C(C)CC(C)OC1=O |
| InChI | InChI=1S/C9H12O3/c1-5-4-6(2)12-9(11)8(5)7(3)10/h6H,4H2,1-3H3 |
| InChIKey | JFBDEERDGWXTGO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|