About acetic acid;1H-quinolin-2-one
acetic acid;1H-quinolin-2-one (PubChem CID 71436806) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is acetic acid;1H-quinolin-2-one.
Molecular Properties
| Compound Name | acetic acid;1H-quinolin-2-one |
| PubChem CID | 71436806 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | acetic acid;1H-quinolin-2-one |
| SMILES | CC(=O)O.O=c1ccc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H7NO.C2H4O2/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2(3)4/h1-6H,(H,10,11);1H3,(H,3,4) |
| InChIKey | IQJOOAQPMQDECI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1H-quinolin-2-one?
The IUPAC name of acetic acid;1H-quinolin-2-one (CID 71436806) is acetic acid;1H-quinolin-2-one.
What is the SMILES notation for acetic acid;1H-quinolin-2-one?
The canonical SMILES for acetic acid;1H-quinolin-2-one is CC(=O)O.O=c1ccc2ccccc2[nH]1.
What is the InChIKey of acetic acid;1H-quinolin-2-one?
The InChIKey is IQJOOAQPMQDECI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C2H4O2/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2(3)4/h1-6H,(H,10,11);1H3,(H,3,4).
What are the key properties of acetic acid;1H-quinolin-2-one?
acetic acid;1H-quinolin-2-one has a molecular weight of 205.21 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1H-quinolin-2-one is sourced from PubChem (CID 71436806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).