About 1-cyclohexylethanone;dioxathiirane 3,3-dioxide
1-cyclohexylethanone;dioxathiirane 3,3-dioxide (PubChem CID 71436930) has the molecular formula C8H14O5S
and a molecular weight of 222.26 g/mol. Its IUPAC name is 1-cyclohexylethanone;dioxathiirane 3,3-dioxide.
Molecular Properties
| Compound Name | 1-cyclohexylethanone;dioxathiirane 3,3-dioxide |
| PubChem CID | 71436930 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-cyclohexylethanone;dioxathiirane 3,3-dioxide |
| SMILES | CC(=O)C1CCCCC1.O=S1(=O)OO1 |
| InChI | InChI=1S/C8H14O.O4S/c1-7(9)8-5-3-2-4-6-8;1-5(2)3-4-5/h8H,2-6H2,1H3; |
| InChIKey | HJVBOGGFRATDIX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 76.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylethanone;dioxathiirane 3,3-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanone;dioxathiirane 3,3-dioxide?
The IUPAC name of 1-cyclohexylethanone;dioxathiirane 3,3-dioxide (CID 71436930) is 1-cyclohexylethanone;dioxathiirane 3,3-dioxide.
What is the SMILES notation for 1-cyclohexylethanone;dioxathiirane 3,3-dioxide?
The canonical SMILES for 1-cyclohexylethanone;dioxathiirane 3,3-dioxide is CC(=O)C1CCCCC1.O=S1(=O)OO1.
What is the InChIKey of 1-cyclohexylethanone;dioxathiirane 3,3-dioxide?
The InChIKey is HJVBOGGFRATDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.O4S/c1-7(9)8-5-3-2-4-6-8;1-5(2)3-4-5/h8H,2-6H2,1H3;.
What are the key properties of 1-cyclohexylethanone;dioxathiirane 3,3-dioxide?
1-cyclohexylethanone;dioxathiirane 3,3-dioxide has a molecular weight of 222.26 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanone;dioxathiirane 3,3-dioxide is sourced from PubChem (CID 71436930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).