2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid

C7H8O4 — CID 71437500

IUPAC2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid
SMILESO=C(O)CC1=COCCC1=O
InChIInChI=1S/C7H8O4/c8-6-1-2-11-4-5(6)3-7(9)10/h4H,1-3H2,(H,9,10)
InChIKeyNDEBBGKFXQDNLC-UHFFFAOYSA-N
MW156.14 g/mol
LogP0.33
Rot. Bonds2

About 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid

2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid (PubChem CID 71437500) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid.

Molecular Properties

Compound Name2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid
PubChem CID71437500
Molecular FormulaC7H8O4
Molecular Weight156.14 g/mol
Exact Mass156.04
IUPAC Name2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid
SMILESO=C(O)CC1=COCCC1=O
InChIInChI=1S/C7H8O4/c8-6-1-2-11-4-5(6)3-7(9)10/h4H,1-3H2,(H,9,10)
InChIKeyNDEBBGKFXQDNLC-UHFFFAOYSA-N
XLogP0.33
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 50.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid?
The IUPAC name of 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid (CID 71437500) is 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid.
What is the SMILES notation for 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid?
The canonical SMILES for 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid is O=C(O)CC1=COCCC1=O.
What is the InChIKey of 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid?
The InChIKey is NDEBBGKFXQDNLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c8-6-1-2-11-4-5(6)3-7(9)10/h4H,1-3H2,(H,9,10).
What are the key properties of 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid?
2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid has a molecular weight of 156.14 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-oxo-2,3-dihydropyran-5-yl)acetic acid is sourced from PubChem (CID 71437500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).