C10H14O — CID 71437887
7-methylidene-1,2,3,3a,4,7a-hexahydroinden-4-ol (PubChem CID 71437887) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 7-methylidene-1,2,3,3a,4,7a-hexahydroinden-4-ol.
| Compound Name | 7-methylidene-1,2,3,3a,4,7a-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 71437887 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 7-methylidene-1,2,3,3a,4,7a-hexahydroinden-4-ol |
| SMILES | C=C1C=CC(O)C2CCCC12 |
| InChI | InChI=1S/C10H14O/c1-7-5-6-10(11)9-4-2-3-8(7)9/h5-6,8-11H,1-4H2 |
| InChIKey | XXJNFHIWIQQXQD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |