About 1-methoxy-1-propa-1,2-dienylcyclohexane
1-methoxy-1-propa-1,2-dienylcyclohexane (PubChem CID 71437950) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-methoxy-1-propa-1,2-dienylcyclohexane.
Molecular Properties
| Compound Name | 1-methoxy-1-propa-1,2-dienylcyclohexane |
| PubChem CID | 71437950 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-methoxy-1-propa-1,2-dienylcyclohexane |
| SMILES | C=C=CC1(OC)CCCCC1 |
| InChI | InChI=1S/C10H16O/c1-3-7-10(11-2)8-5-4-6-9-10/h7H,1,4-6,8-9H2,2H3 |
| InChIKey | URIKQIWUCPWAGX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxy-1-propa-1,2-dienylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1-propa-1,2-dienylcyclohexane?
The IUPAC name of 1-methoxy-1-propa-1,2-dienylcyclohexane (CID 71437950) is 1-methoxy-1-propa-1,2-dienylcyclohexane.
What is the SMILES notation for 1-methoxy-1-propa-1,2-dienylcyclohexane?
The canonical SMILES for 1-methoxy-1-propa-1,2-dienylcyclohexane is C=C=CC1(OC)CCCCC1.
What is the InChIKey of 1-methoxy-1-propa-1,2-dienylcyclohexane?
The InChIKey is URIKQIWUCPWAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-3-7-10(11-2)8-5-4-6-9-10/h7H,1,4-6,8-9H2,2H3.
What are the key properties of 1-methoxy-1-propa-1,2-dienylcyclohexane?
1-methoxy-1-propa-1,2-dienylcyclohexane has a molecular weight of 152.24 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1-propa-1,2-dienylcyclohexane is sourced from PubChem (CID 71437950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).