C36H50O4 — CID 71438290
[17-(5-ethyl-6-methylhept-1-en-2-yl)-11-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 71438290) has the molecular formula C36H50O4 and a molecular weight of 546.79 g/mol. Its IUPAC name is [17-(5-ethyl-6-methylhept-1-en-2-yl)-11-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [17-(5-ethyl-6-methylhept-1-en-2-yl)-11-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 71438290 |
| Molecular Formula | C36H50O4 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | [17-(5-ethyl-6-methylhept-1-en-2-yl)-11-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C=C(CCC(CC)C(C)C)C1CCC2C3=CC(=O)C4CC(OC(=O)c5ccccc5)CCC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C36H50O4/c1-7-24(22(2)3)14-13-23(4)28-15-16-29-27-20-31(37)30-19-26(40-34(39)25-11-9-8-10-12-25)17-18-35(30,5)33(27)32(38)21-36(28,29)6/h8-12,20,22,24,26,28-30,32-33,38H,4,7,13-19,21H2,1-3,5-6H3 |
| InChIKey | AKYLOCBWNOEPCY-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|