C16H12F5NO — CID 71438363
3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3-oxazolidine (PubChem CID 71438363) has the molecular formula C16H12F5NO and a molecular weight of 329.27 g/mol. Its IUPAC name is 3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3-oxazolidine.
| Compound Name | 3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 71438363 |
| Molecular Formula | C16H12F5NO |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-methyl-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3-oxazolidine |
| SMILES | CN1CC(c2ccccc2)OC1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H12F5NO/c1-22-7-9(8-5-3-2-4-6-8)23-16(22)10-11(17)13(19)15(21)14(20)12(10)18/h2-6,9,16H,7H2,1H3 |
| InChIKey | FEQTXDRXFDTACA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|