C18H14O5 — CID 71438742
5-hydroxy-11-methoxy-2-methyl-8,9-dihydroindeno[5,6-h]chromene-4,10-dione (PubChem CID 71438742) has the molecular formula C18H14O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-hydroxy-11-methoxy-2-methyl-8,9-dihydroindeno[5,6-h]chromene-4,10-dione.
| Compound Name | 5-hydroxy-11-methoxy-2-methyl-8,9-dihydroindeno[5,6-h]chromene-4,10-dione |
|---|---|
| PubChem CID | 71438742 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 5-hydroxy-11-methoxy-2-methyl-8,9-dihydroindeno[5,6-h]chromene-4,10-dione |
| SMILES | COc1c2c(cc3cc(O)c4c(=O)cc(C)oc4c13)CCC2=O |
| InChI | InChI=1S/C18H14O5/c1-8-5-12(20)16-13(21)7-10-6-9-3-4-11(19)14(9)17(22-2)15(10)18(16)23-8/h5-7,21H,3-4H2,1-2H3 |
| InChIKey | PAPDLIMQTJVGKM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|