C18H10O2 — CID 71438939
tetracyclo[12.4.0.02,5.06,11]octadeca-1(18),2(5),6,8,10,12,14,16-octaene-3,4-dione (PubChem CID 71438939) has the molecular formula C18H10O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is tetracyclo[12.4.0.02,5.06,11]octadeca-1(18),2(5),6,8,10,12,14,16-octaene-3,4-dione.
| Compound Name | tetracyclo[12.4.0.02,5.06,11]octadeca-1(18),2(5),6,8,10,12,14,16-octaene-3,4-dione |
|---|---|
| PubChem CID | 71438939 |
| Molecular Formula | C18H10O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | tetracyclo[12.4.0.02,5.06,11]octadeca-1(18),2(5),6,8,10,12,14,16-octaene-3,4-dione |
| SMILES | O=c1c2c(c1=O)-c1ccccc1C=Cc1ccccc1-2 |
| InChI | InChI=1S/C18H10O2/c19-17-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16(15)18(17)20/h1-10H/b10-9?,11-9?,12-10?,15-13+,16-14+ |
| InChIKey | NAHZPGGMQSOQAJ-DVYCXHTPSA-N |
| XLogP | 3.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|