About 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide
2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 71439219) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| PubChem CID | 71439219 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CC(O)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C11H23NO2/c1-8(13)9(14)12-11(5,6)7-10(2,3)4/h8,13H,7H2,1-6H3,(H,12,14) |
| InChIKey | PAJBLXYTXWUCCX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The IUPAC name of 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide (CID 71439219) is 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide.
What is the SMILES notation for 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The canonical SMILES for 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide is CC(O)C(=O)NC(C)(C)CC(C)(C)C.
What is the InChIKey of 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide?
The InChIKey is PAJBLXYTXWUCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-8(13)9(14)12-11(5,6)7-10(2,3)4/h8,13H,7H2,1-6H3,(H,12,14).
What are the key properties of 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide?
2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide has a molecular weight of 201.31 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-(2,4,4-trimethylpentan-2-yl)propanamide is sourced from PubChem (CID 71439219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).