C12H25NO4S2 — CID 71439540
sulfuric acid;2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethanethiol (PubChem CID 71439540) has the molecular formula C12H25NO4S2 and a molecular weight of 311.47 g/mol. Its IUPAC name is sulfuric acid;2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethanethiol.
| Compound Name | sulfuric acid;2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethanethiol |
|---|---|
| PubChem CID | 71439540 |
| Molecular Formula | C12H25NO4S2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | sulfuric acid;2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]ethanethiol |
| SMILES | CC1(C)C2CCC1(C)C(NCCS)C2.O=S(=O)(O)O |
| InChI | InChI=1S/C12H23NS.H2O4S/c1-11(2)9-4-5-12(11,3)10(8-9)13-6-7-14;1-5(2,3)4/h9-10,13-14H,4-8H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | RVABJJVDDJWNAG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|