About (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate
(1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate (PubChem CID 71439646) has the molecular formula C10H19NO5
and a molecular weight of 233.26 g/mol. Its IUPAC name is (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate |
| PubChem CID | 71439646 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate |
| SMILES | C[NH+](C)C(C)(C)CO.O=C([O-])C=CC(=O)O |
| InChI | InChI=1S/C6H15NO.C4H4O4/c1-6(2,5-8)7(3)4;5-3(6)1-2-4(7)8/h8H,5H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RQCQIRYIZGPBET-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate?
The IUPAC name of (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate (CID 71439646) is (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate.
What is the SMILES notation for (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate?
The canonical SMILES for (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate is C[NH+](C)C(C)(C)CO.O=C([O-])C=CC(=O)O.
What is the InChIKey of (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate?
The InChIKey is RQCQIRYIZGPBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO.C4H4O4/c1-6(2,5-8)7(3)4;5-3(6)1-2-4(7)8/h8H,5H2,1-4H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate?
(1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate has a molecular weight of 233.26 g/mol, XLogP of -2.72, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-2-methylpropan-2-yl)-dimethylazanium;4-hydroxy-4-oxobut-2-enoate is sourced from PubChem (CID 71439646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).