C10H11ClO3 — CID 71439675
6-methyl-2-oxo-3,4,5,7a-tetrahydro-1-benzofuran-3a-carbonyl chloride (PubChem CID 71439675) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 6-methyl-2-oxo-3,4,5,7a-tetrahydro-1-benzofuran-3a-carbonyl chloride.
| Compound Name | 6-methyl-2-oxo-3,4,5,7a-tetrahydro-1-benzofuran-3a-carbonyl chloride |
|---|---|
| PubChem CID | 71439675 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 6-methyl-2-oxo-3,4,5,7a-tetrahydro-1-benzofuran-3a-carbonyl chloride |
| SMILES | CC1=CC2OC(=O)CC2(C(=O)Cl)CC1 |
| InChI | InChI=1S/C10H11ClO3/c1-6-2-3-10(9(11)13)5-8(12)14-7(10)4-6/h4,7H,2-3,5H2,1H3 |
| InChIKey | VNUKOLIIIUCNAU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|