C19H13ClN2NaO2 — CID 71439818
CID 71439818 (PubChem CID 71439818) has the molecular formula C19H13ClN2NaO2 and a molecular weight of 359.77 g/mol.
| Compound Name | CID 71439818 |
|---|---|
| PubChem CID | 71439818 |
| Molecular Formula | C19H13ClN2NaO2 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc2c(cc1O)[nH]c1ccccc12.[Na] |
| InChI | InChI=1S/C19H13ClN2O2.Na/c20-11-5-7-12(8-6-11)21-19(24)15-9-14-13-3-1-2-4-16(13)22-17(14)10-18(15)23;/h1-10,22-23H,(H,21,24); |
| InChIKey | KUMGKEVFFVHHKU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |