C15H26O — CID 71439866
4,5,5-triethyl-2,3,4-trimethylcyclohex-2-en-1-one (PubChem CID 71439866) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 4,5,5-triethyl-2,3,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 4,5,5-triethyl-2,3,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 71439866 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 4,5,5-triethyl-2,3,4-trimethylcyclohex-2-en-1-one |
| SMILES | CCC1(CC)CC(=O)C(C)=C(C)C1(C)CC |
| InChI | InChI=1S/C15H26O/c1-7-14(6)12(5)11(4)13(16)10-15(14,8-2)9-3/h7-10H2,1-6H3 |
| InChIKey | JAXDNXNTJWNZKE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |