About 2-methoxy-4-methylphenol
2-methoxy-4-methylphenol (PubChem CID 7144) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-methoxy-4-methylphenol.
Molecular Properties
| Compound Name | 2-methoxy-4-methylphenol |
| PubChem CID | 7144 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 2-methoxy-4-methylphenol |
| SMILES | COc1cc(C)ccc1O |
| InChI | InChI=1S/C8H10O2/c1-6-3-4-7(9)8(5-6)10-2/h3-5,9H,1-2H3 |
| InChIKey | PETRWTHZSKVLRE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-methylphenol?
The IUPAC name of 2-methoxy-4-methylphenol (CID 7144) is 2-methoxy-4-methylphenol.
What is the SMILES notation for 2-methoxy-4-methylphenol?
The canonical SMILES for 2-methoxy-4-methylphenol is COc1cc(C)ccc1O.
What is the InChIKey of 2-methoxy-4-methylphenol?
The InChIKey is PETRWTHZSKVLRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-6-3-4-7(9)8(5-6)10-2/h3-5,9H,1-2H3.
What are the key properties of 2-methoxy-4-methylphenol?
2-methoxy-4-methylphenol has a molecular weight of 138.17 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-methylphenol is sourced from PubChem (CID 7144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).