About 1,1,3-triethoxyundec-4-ene
1,1,3-triethoxyundec-4-ene (PubChem CID 71440114) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is 1,1,3-triethoxyundec-4-ene.
Molecular Properties
| Compound Name | 1,1,3-triethoxyundec-4-ene |
| PubChem CID | 71440114 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 1,1,3-triethoxyundec-4-ene |
| SMILES | CCCCCCC=CC(CC(OCC)OCC)OCC |
| InChI | InChI=1S/C17H34O3/c1-5-9-10-11-12-13-14-16(18-6-2)15-17(19-7-3)20-8-4/h13-14,16-17H,5-12,15H2,1-4H3 |
| InChIKey | NXYOWUFBHVQRNC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-triethoxyundec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-triethoxyundec-4-ene?
The IUPAC name of 1,1,3-triethoxyundec-4-ene (CID 71440114) is 1,1,3-triethoxyundec-4-ene.
What is the SMILES notation for 1,1,3-triethoxyundec-4-ene?
The canonical SMILES for 1,1,3-triethoxyundec-4-ene is CCCCCCC=CC(CC(OCC)OCC)OCC.
What is the InChIKey of 1,1,3-triethoxyundec-4-ene?
The InChIKey is NXYOWUFBHVQRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3/c1-5-9-10-11-12-13-14-16(18-6-2)15-17(19-7-3)20-8-4/h13-14,16-17H,5-12,15H2,1-4H3.
What are the key properties of 1,1,3-triethoxyundec-4-ene?
1,1,3-triethoxyundec-4-ene has a molecular weight of 286.46 g/mol, XLogP of 4.71, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-triethoxyundec-4-ene is sourced from PubChem (CID 71440114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).