C15H28O3 — CID 71440115
7,9,9-triethoxynona-3,5-diene (PubChem CID 71440115) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 7,9,9-triethoxynona-3,5-diene.
| Compound Name | 7,9,9-triethoxynona-3,5-diene |
|---|---|
| PubChem CID | 71440115 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 7,9,9-triethoxynona-3,5-diene |
| SMILES | CCC=CC=CC(CC(OCC)OCC)OCC |
| InChI | InChI=1S/C15H28O3/c1-5-9-10-11-12-14(16-6-2)13-15(17-7-3)18-8-4/h9-12,14-15H,5-8,13H2,1-4H3 |
| InChIKey | RTEIGGOBUZSFHU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|