C15H14O6 — CID 71440148
3-(4,5-dihydroxycyclohexa-2,4-dien-1-yl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 71440148) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is 3-(4,5-dihydroxycyclohexa-2,4-dien-1-yl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4,5-dihydroxycyclohexa-2,4-dien-1-yl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71440148 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-(4,5-dihydroxycyclohexa-2,4-dien-1-yl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(C=CC1C=CC(O)=C(O)C1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C15H14O6/c16-10(9-3-6-12(18)15(21)14(9)20)4-1-8-2-5-11(17)13(19)7-8/h1-6,8,17-21H,7H2 |
| InChIKey | IFEJGLJCZWYXKT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|