About 5-amino-6-methylpyrazine-2,3-dicarbonitrile
5-amino-6-methylpyrazine-2,3-dicarbonitrile (PubChem CID 71440315) has the molecular formula C7H5N5
and a molecular weight of 159.15 g/mol. Its IUPAC name is 5-amino-6-methylpyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-amino-6-methylpyrazine-2,3-dicarbonitrile |
| PubChem CID | 71440315 |
| Molecular Formula | C7H5N5 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 5-amino-6-methylpyrazine-2,3-dicarbonitrile |
| SMILES | Cc1nc(C#N)c(C#N)nc1N |
| InChI | InChI=1S/C7H5N5/c1-4-7(10)12-6(3-9)5(2-8)11-4/h1H3,(H2,10,12) |
| InChIKey | ZOJYZNITKWHVBU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-6-methylpyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-methylpyrazine-2,3-dicarbonitrile?
The IUPAC name of 5-amino-6-methylpyrazine-2,3-dicarbonitrile (CID 71440315) is 5-amino-6-methylpyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 5-amino-6-methylpyrazine-2,3-dicarbonitrile?
The canonical SMILES for 5-amino-6-methylpyrazine-2,3-dicarbonitrile is Cc1nc(C#N)c(C#N)nc1N.
What is the InChIKey of 5-amino-6-methylpyrazine-2,3-dicarbonitrile?
The InChIKey is ZOJYZNITKWHVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5/c1-4-7(10)12-6(3-9)5(2-8)11-4/h1H3,(H2,10,12).
What are the key properties of 5-amino-6-methylpyrazine-2,3-dicarbonitrile?
5-amino-6-methylpyrazine-2,3-dicarbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-methylpyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 71440315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).