About 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate
4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate (PubChem CID 71441342) has the molecular formula C21H31O7-
and a molecular weight of 395.47 g/mol. Its IUPAC name is 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate.
Molecular Properties
| Compound Name | 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate |
| PubChem CID | 71441342 |
| Molecular Formula | C21H31O7- |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate |
| SMILES | CC1=CC(=O)C(OC(=O)CCC(=O)[O-])CCCCCCCCCC(C)OC1=O |
| InChI | InChI=1S/C21H32O7/c1-15-14-17(22)18(28-20(25)13-12-19(23)24)11-9-7-5-3-4-6-8-10-16(2)27-21(15)26/h14,16,18H,3-13H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | JERFBNZLFDZJGI-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate?
The IUPAC name of 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate (CID 71441342) is 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate.
What is the SMILES notation for 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate?
The canonical SMILES for 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate is CC1=CC(=O)C(OC(=O)CCC(=O)[O-])CCCCCCCCCC(C)OC1=O.
What is the InChIKey of 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate?
The InChIKey is JERFBNZLFDZJGI-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H32O7/c1-15-14-17(22)18(28-20(25)13-12-19(23)24)11-9-7-5-3-4-6-8-10-16(2)27-21(15)26/h14,16,18H,3-13H2,1-2H3,(H,23,24)/p-1.
What are the key properties of 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate?
4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate has a molecular weight of 395.47 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,16-dimethyl-2,5-dioxo-1-oxacyclohexadec-3-en-6-yl)oxy]-4-oxobutanoate is sourced from PubChem (CID 71441342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).