About 6-hydroxy-6,10-dimethylundec-9-en-2-one
6-hydroxy-6,10-dimethylundec-9-en-2-one (PubChem CID 71441531) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 6-hydroxy-6,10-dimethylundec-9-en-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-6,10-dimethylundec-9-en-2-one |
| PubChem CID | 71441531 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 6-hydroxy-6,10-dimethylundec-9-en-2-one |
| SMILES | CC(=O)CCCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C13H24O2/c1-11(2)7-5-9-13(4,15)10-6-8-12(3)14/h7,15H,5-6,8-10H2,1-4H3 |
| InChIKey | CDKQBQKBJFQPSD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-6,10-dimethylundec-9-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-6,10-dimethylundec-9-en-2-one?
The IUPAC name of 6-hydroxy-6,10-dimethylundec-9-en-2-one (CID 71441531) is 6-hydroxy-6,10-dimethylundec-9-en-2-one.
What is the SMILES notation for 6-hydroxy-6,10-dimethylundec-9-en-2-one?
The canonical SMILES for 6-hydroxy-6,10-dimethylundec-9-en-2-one is CC(=O)CCCC(C)(O)CCC=C(C)C.
What is the InChIKey of 6-hydroxy-6,10-dimethylundec-9-en-2-one?
The InChIKey is CDKQBQKBJFQPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-11(2)7-5-9-13(4,15)10-6-8-12(3)14/h7,15H,5-6,8-10H2,1-4H3.
What are the key properties of 6-hydroxy-6,10-dimethylundec-9-en-2-one?
6-hydroxy-6,10-dimethylundec-9-en-2-one has a molecular weight of 212.33 g/mol, XLogP of 3.24, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-6,10-dimethylundec-9-en-2-one is sourced from PubChem (CID 71441531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).