About 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane
2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane (PubChem CID 71441709) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane.
Molecular Properties
| Compound Name | 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane |
| PubChem CID | 71441709 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane |
| SMILES | C=C(C)C=CCC1(C)OC1C |
| InChI | InChI=1S/C10H16O/c1-8(2)6-5-7-10(4)9(3)11-10/h5-6,9H,1,7H2,2-4H3 |
| InChIKey | FDZVPGIFEBSXGG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane?
The IUPAC name of 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane (CID 71441709) is 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane.
What is the SMILES notation for 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane?
The canonical SMILES for 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane is C=C(C)C=CCC1(C)OC1C.
What is the InChIKey of 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane?
The InChIKey is FDZVPGIFEBSXGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-8(2)6-5-7-10(4)9(3)11-10/h5-6,9H,1,7H2,2-4H3.
What are the key properties of 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane?
2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane has a molecular weight of 152.24 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-2-(4-methylpenta-2,4-dienyl)oxirane is sourced from PubChem (CID 71441709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).