C10H13F7O — CID 71442100
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methylcyclohexan-1-ol (PubChem CID 71442100) has the molecular formula C10H13F7O and a molecular weight of 282.20 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methylcyclohexan-1-ol.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 71442100 |
| Molecular Formula | C10H13F7O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methylcyclohexan-1-ol |
| SMILES | CC1CCC(C(F)(C(F)(F)F)C(F)(F)F)C(O)C1 |
| InChI | InChI=1S/C10H13F7O/c1-5-2-3-6(7(18)4-5)8(11,9(12,13)14)10(15,16)17/h5-7,18H,2-4H2,1H3 |
| InChIKey | RYMFLNQDHZXPER-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |