C17H25F9O2S — CID 71442125
11-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)undecanoic acid (PubChem CID 71442125) has the molecular formula C17H25F9O2S and a molecular weight of 464.43 g/mol. Its IUPAC name is 11-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)undecanoic acid.
| Compound Name | 11-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)undecanoic acid |
|---|---|
| PubChem CID | 71442125 |
| Molecular Formula | C17H25F9O2S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 11-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H25F9O2S/c18-14(19,15(20,21)16(22,23)17(24,25)26)10-12-29-11-8-6-4-2-1-3-5-7-9-13(27)28/h1-12H2,(H,27,28) |
| InChIKey | ZYJIEJNVWBCVLS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|