C14H18N2O5 — CID 71442189
oxalic acid;1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-one (PubChem CID 71442189) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is oxalic acid;1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-one.
| Compound Name | oxalic acid;1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 71442189 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | oxalic acid;1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CCCC1)c1ccccn1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H16N2O.C2H2O4/c15-12(11-5-1-2-7-13-11)6-10-14-8-3-4-9-14;3-1(4)2(5)6/h1-2,5,7H,3-4,6,8-10H2;(H,3,4)(H,5,6) |
| InChIKey | WZFBHQGNVLPQLE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|