About (2S,5R)-2,5-dihydrofuran-2,5-diol
(2S,5R)-2,5-dihydrofuran-2,5-diol (PubChem CID 71442334) has the molecular formula C4H6O3
and a molecular weight of 102.09 g/mol. Its IUPAC name is (2S,5R)-2,5-dihydrofuran-2,5-diol.
Molecular Properties
| Compound Name | (2S,5R)-2,5-dihydrofuran-2,5-diol |
| PubChem CID | 71442334 |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | (2S,5R)-2,5-dihydrofuran-2,5-diol |
| SMILES | O[C@@H]1C=C[C@H](O)O1 |
| InChI | InChI=1S/C4H6O3/c5-3-1-2-4(6)7-3/h1-6H/t3-,4+ |
| InChIKey | AQSRSYODIBLNLR-ZXZARUISSA-N |
| XLogP | -0.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-2,5-dihydrofuran-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2,5-dihydrofuran-2,5-diol?
The IUPAC name of (2S,5R)-2,5-dihydrofuran-2,5-diol (CID 71442334) is (2S,5R)-2,5-dihydrofuran-2,5-diol.
What is the SMILES notation for (2S,5R)-2,5-dihydrofuran-2,5-diol?
The canonical SMILES for (2S,5R)-2,5-dihydrofuran-2,5-diol is O[C@@H]1C=C[C@H](O)O1.
What is the InChIKey of (2S,5R)-2,5-dihydrofuran-2,5-diol?
The InChIKey is AQSRSYODIBLNLR-ZXZARUISSA-N. The full InChI is InChI=1S/C4H6O3/c5-3-1-2-4(6)7-3/h1-6H/t3-,4+.
What are the key properties of (2S,5R)-2,5-dihydrofuran-2,5-diol?
(2S,5R)-2,5-dihydrofuran-2,5-diol has a molecular weight of 102.09 g/mol, XLogP of -0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2,5-dihydrofuran-2,5-diol is sourced from PubChem (CID 71442334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).