About triphenyl(3,3,3-trifluoroprop-1-ynyl)silane
triphenyl(3,3,3-trifluoroprop-1-ynyl)silane (PubChem CID 71442915) has the molecular formula C21H15F3Si
and a molecular weight of 352.43 g/mol. Its IUPAC name is triphenyl(3,3,3-trifluoroprop-1-ynyl)silane.
Molecular Properties
| Compound Name | triphenyl(3,3,3-trifluoroprop-1-ynyl)silane |
| PubChem CID | 71442915 |
| Molecular Formula | C21H15F3Si |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | triphenyl(3,3,3-trifluoroprop-1-ynyl)silane |
| SMILES | FC(F)(F)C#C[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15F3Si/c22-21(23,24)16-17-25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H |
| InChIKey | ZYNDKJCURLQVDT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triphenyl(3,3,3-trifluoroprop-1-ynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl(3,3,3-trifluoroprop-1-ynyl)silane?
The IUPAC name of triphenyl(3,3,3-trifluoroprop-1-ynyl)silane (CID 71442915) is triphenyl(3,3,3-trifluoroprop-1-ynyl)silane.
What is the SMILES notation for triphenyl(3,3,3-trifluoroprop-1-ynyl)silane?
The canonical SMILES for triphenyl(3,3,3-trifluoroprop-1-ynyl)silane is FC(F)(F)C#C[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of triphenyl(3,3,3-trifluoroprop-1-ynyl)silane?
The InChIKey is ZYNDKJCURLQVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3Si/c22-21(23,24)16-17-25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H.
What are the key properties of triphenyl(3,3,3-trifluoroprop-1-ynyl)silane?
triphenyl(3,3,3-trifluoroprop-1-ynyl)silane has a molecular weight of 352.43 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl(3,3,3-trifluoroprop-1-ynyl)silane is sourced from PubChem (CID 71442915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).