About aniline;oxalic acid
aniline;oxalic acid (PubChem CID 71443120) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is aniline;oxalic acid.
Molecular Properties
| Compound Name | aniline;oxalic acid |
| PubChem CID | 71443120 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | aniline;oxalic acid |
| SMILES | Nc1ccccc1.Nc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C6H7N.C2H2O4/c2*7-6-4-2-1-3-5-6;3-1(4)2(5)6/h2*1-5H,7H2;(H,3,4)(H,5,6) |
| InChIKey | KTFFTVGPHKWIOK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze aniline;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;oxalic acid?
The IUPAC name of aniline;oxalic acid (CID 71443120) is aniline;oxalic acid.
What is the SMILES notation for aniline;oxalic acid?
The canonical SMILES for aniline;oxalic acid is Nc1ccccc1.Nc1ccccc1.O=C(O)C(=O)O.
What is the InChIKey of aniline;oxalic acid?
The InChIKey is KTFFTVGPHKWIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7N.C2H2O4/c2*7-6-4-2-1-3-5-6;3-1(4)2(5)6/h2*1-5H,7H2;(H,3,4)(H,5,6).
What are the key properties of aniline;oxalic acid?
aniline;oxalic acid has a molecular weight of 276.29 g/mol, XLogP of 1.69, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;oxalic acid is sourced from PubChem (CID 71443120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).