C24H44O2S4 — CID 71443232
2-[9-[2-[4-(1,3-dithian-2-yl)butyl]-1,3-dithian-2-yl]nonyl]-1,3-dioxolane (PubChem CID 71443232) has the molecular formula C24H44O2S4 and a molecular weight of 492.88 g/mol. Its IUPAC name is 2-[9-[2-[4-(1,3-dithian-2-yl)butyl]-1,3-dithian-2-yl]nonyl]-1,3-dioxolane.
| Compound Name | 2-[9-[2-[4-(1,3-dithian-2-yl)butyl]-1,3-dithian-2-yl]nonyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 71443232 |
| Molecular Formula | C24H44O2S4 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-[9-[2-[4-(1,3-dithian-2-yl)butyl]-1,3-dithian-2-yl]nonyl]-1,3-dioxolane |
| SMILES | C(CCCCC1OCCO1)CCCCC1(CCCCC2SCCCS2)SCCCS1 |
| InChI | InChI=1S/C24H44O2S4/c1(2-4-6-12-22-25-16-17-26-22)3-5-8-14-24(29-20-11-21-30-24)15-9-7-13-23-27-18-10-19-28-23/h22-23H,1-21H2 |
| InChIKey | JMPIMSYQMMFSDI-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|