About 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile
2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 71443433) has the molecular formula C19H16N6
and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile.
Molecular Properties
| Compound Name | 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile |
| PubChem CID | 71443433 |
| Molecular Formula | C19H16N6 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | CCN(CC)c1ccc(/N=N/c2c(C#N)cc(C#N)cc2C#N)cc1 |
| InChI | InChI=1S/C19H16N6/c1-3-25(4-2)18-7-5-17(6-8-18)23-24-19-15(12-21)9-14(11-20)10-16(19)13-22/h5-10H,3-4H2,1-2H3/b24-23+ |
| InChIKey | LMGBYUPVJBFKNZ-WCWDXBQESA-N |
| XLogP | 4.56 |
| TPSA | 99.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile?
The IUPAC name of 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile (CID 71443433) is 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile.
What is the SMILES notation for 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile?
The canonical SMILES for 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile is CCN(CC)c1ccc(/N=N/c2c(C#N)cc(C#N)cc2C#N)cc1.
What is the InChIKey of 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile?
The InChIKey is LMGBYUPVJBFKNZ-WCWDXBQESA-N. The full InChI is InChI=1S/C19H16N6/c1-3-25(4-2)18-7-5-17(6-8-18)23-24-19-15(12-21)9-14(11-20)10-16(19)13-22/h5-10H,3-4H2,1-2H3/b24-23+.
What are the key properties of 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile?
2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile has a molecular weight of 328.38 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(diethylamino)phenyl]diazenyl]benzene-1,3,5-tricarbonitrile is sourced from PubChem (CID 71443433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).