C12H7F9O3S — CID 71443515
2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-phenylethanone (PubChem CID 71443515) has the molecular formula C12H7F9O3S and a molecular weight of 402.23 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-phenylethanone.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-phenylethanone |
|---|---|
| PubChem CID | 71443515 |
| Molecular Formula | C12H7F9O3S |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-1-phenylethanone |
| SMILES | O=C(CS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H7F9O3S/c13-9(14,11(17,18)19)10(15,16)12(20,21)25(23,24)6-8(22)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | LGUFKWJTKTVTLU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|