C19H38N2O2Sn — CID 71443621
ethyl 2-diazo-2-[tris(2,2-dimethylpropyl)stannyl]acetate (PubChem CID 71443621) has the molecular formula C19H38N2O2Sn and a molecular weight of 445.24 g/mol. Its IUPAC name is ethyl 2-diazo-2-[tris(2,2-dimethylpropyl)stannyl]acetate.
| Compound Name | ethyl 2-diazo-2-[tris(2,2-dimethylpropyl)stannyl]acetate |
|---|---|
| PubChem CID | 71443621 |
| Molecular Formula | C19H38N2O2Sn |
| Molecular Weight | 445.24 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | ethyl 2-diazo-2-[tris(2,2-dimethylpropyl)stannyl]acetate |
| SMILES | CCOC(=O)C(=[N+]=[N-])[Sn](CC(C)(C)C)(CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/3C5H11.C4H5N2O2.Sn/c3*1-5(2,3)4;1-2-8-4(7)3-6-5;/h3*1H2,2-4H3;2H2,1H3; |
| InChIKey | OVKFSSYXLVLCKP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.24 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|