C5H8N4O3 — CID 71443744
N-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydroxylamine (PubChem CID 71443744) has the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. Its IUPAC name is N-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydroxylamine.
| Compound Name | N-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 71443744 |
| Molecular Formula | C5H8N4O3 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | N-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydroxylamine |
| SMILES | COc1nc(NO)nc(OC)n1 |
| InChI | InChI=1S/C5H8N4O3/c1-11-4-6-3(9-10)7-5(8-4)12-2/h10H,1-2H3,(H,6,7,8,9) |
| InChIKey | WRBBZYORRSENMS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|