About 7-pentylidenetridecane
7-pentylidenetridecane (PubChem CID 71444589) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is 7-pentylidenetridecane.
Molecular Properties
| Compound Name | 7-pentylidenetridecane |
| PubChem CID | 71444589 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 7-pentylidenetridecane |
| SMILES | CCCCC=C(CCCCCC)CCCCCC |
| InChI | InChI=1S/C18H36/c1-4-7-10-13-16-18(15-12-9-6-3)17-14-11-8-5-2/h15H,4-14,16-17H2,1-3H3 |
| InChIKey | ZOAQPZPVKINTDC-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-pentylidenetridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pentylidenetridecane?
The IUPAC name of 7-pentylidenetridecane (CID 71444589) is 7-pentylidenetridecane.
What is the SMILES notation for 7-pentylidenetridecane?
The canonical SMILES for 7-pentylidenetridecane is CCCCC=C(CCCCCC)CCCCCC.
What is the InChIKey of 7-pentylidenetridecane?
The InChIKey is ZOAQPZPVKINTDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36/c1-4-7-10-13-16-18(15-12-9-6-3)17-14-11-8-5-2/h15H,4-14,16-17H2,1-3H3.
What are the key properties of 7-pentylidenetridecane?
7-pentylidenetridecane has a molecular weight of 252.49 g/mol, XLogP of 7.04, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pentylidenetridecane is sourced from PubChem (CID 71444589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).