C12H21N5O6 — CID 71444758
bis(propan-1-amine);1,3,5-trinitrobenzene (PubChem CID 71444758) has the molecular formula C12H21N5O6 and a molecular weight of 331.33 g/mol. Its IUPAC name is bis(propan-1-amine);1,3,5-trinitrobenzene.
| Compound Name | bis(propan-1-amine);1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 71444758 |
| Molecular Formula | C12H21N5O6 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | bis(propan-1-amine);1,3,5-trinitrobenzene |
| SMILES | CCCN.CCCN.O=[N+]([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O6.2C3H9N/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;2*1-2-3-4/h1-3H;2*2-4H2,1H3 |
| InChIKey | IPDKTLVVRWRLNT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|