C21H31BO2 — CID 71445105
(4S,6R)-4,6-dicyclohexyl-2-phenyl-1,3,2-dioxaborinane (PubChem CID 71445105) has the molecular formula C21H31BO2 and a molecular weight of 326.29 g/mol. Its IUPAC name is (4S,6R)-4,6-dicyclohexyl-2-phenyl-1,3,2-dioxaborinane.
| Compound Name | (4S,6R)-4,6-dicyclohexyl-2-phenyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 71445105 |
| Molecular Formula | C21H31BO2 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (4S,6R)-4,6-dicyclohexyl-2-phenyl-1,3,2-dioxaborinane |
| SMILES | c1ccc(B2O[C@H](C3CCCCC3)C[C@H](C3CCCCC3)O2)cc1 |
| InChI | InChI=1S/C21H31BO2/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)24-22(23-20)19-14-8-3-9-15-19/h3,8-9,14-15,17-18,20-21H,1-2,4-7,10-13,16H2/t20-,21+ |
| InChIKey | VKLBVOYWNOSDKR-OYRHEFFESA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|