About 4-azaspiro[2.4]hepta-1,4,6-triene
4-azaspiro[2.4]hepta-1,4,6-triene (PubChem CID 71445357) has the molecular formula C6H5N
and a molecular weight of 91.11 g/mol. Its IUPAC name is 4-azaspiro[2.4]hepta-1,4,6-triene.
Molecular Properties
| Compound Name | 4-azaspiro[2.4]hepta-1,4,6-triene |
| PubChem CID | 71445357 |
| Molecular Formula | C6H5N |
| Molecular Weight | 91.11 g/mol |
| Exact Mass | 91.04 |
| IUPAC Name | 4-azaspiro[2.4]hepta-1,4,6-triene |
| SMILES | C1=CC2(C=C2)N=C1 |
| InChI | InChI=1S/C6H5N/c1-2-6(3-4-6)7-5-1/h1-5H |
| InChIKey | CJFQLDMTMOIVSE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.11 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-azaspiro[2.4]hepta-1,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azaspiro[2.4]hepta-1,4,6-triene?
The IUPAC name of 4-azaspiro[2.4]hepta-1,4,6-triene (CID 71445357) is 4-azaspiro[2.4]hepta-1,4,6-triene.
What is the SMILES notation for 4-azaspiro[2.4]hepta-1,4,6-triene?
The canonical SMILES for 4-azaspiro[2.4]hepta-1,4,6-triene is C1=CC2(C=C2)N=C1.
What is the InChIKey of 4-azaspiro[2.4]hepta-1,4,6-triene?
The InChIKey is CJFQLDMTMOIVSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N/c1-2-6(3-4-6)7-5-1/h1-5H.
What are the key properties of 4-azaspiro[2.4]hepta-1,4,6-triene?
4-azaspiro[2.4]hepta-1,4,6-triene has a molecular weight of 91.11 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azaspiro[2.4]hepta-1,4,6-triene is sourced from PubChem (CID 71445357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).