About 1-bromo-2,3-bis(ethylsulfanyl)propane
1-bromo-2,3-bis(ethylsulfanyl)propane (PubChem CID 71445886) has the molecular formula C7H15BrS2
and a molecular weight of 243.23 g/mol. Its IUPAC name is 1-bromo-2,3-bis(ethylsulfanyl)propane.
Molecular Properties
| Compound Name | 1-bromo-2,3-bis(ethylsulfanyl)propane |
| PubChem CID | 71445886 |
| Molecular Formula | C7H15BrS2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 1-bromo-2,3-bis(ethylsulfanyl)propane |
| SMILES | CCSCC(CBr)SCC |
| InChI | InChI=1S/C7H15BrS2/c1-3-9-6-7(5-8)10-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | AOAXKNPQTYXVHP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,3-bis(ethylsulfanyl)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3-bis(ethylsulfanyl)propane?
The IUPAC name of 1-bromo-2,3-bis(ethylsulfanyl)propane (CID 71445886) is 1-bromo-2,3-bis(ethylsulfanyl)propane.
What is the SMILES notation for 1-bromo-2,3-bis(ethylsulfanyl)propane?
The canonical SMILES for 1-bromo-2,3-bis(ethylsulfanyl)propane is CCSCC(CBr)SCC.
What is the InChIKey of 1-bromo-2,3-bis(ethylsulfanyl)propane?
The InChIKey is AOAXKNPQTYXVHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15BrS2/c1-3-9-6-7(5-8)10-4-2/h7H,3-6H2,1-2H3.
What are the key properties of 1-bromo-2,3-bis(ethylsulfanyl)propane?
1-bromo-2,3-bis(ethylsulfanyl)propane has a molecular weight of 243.23 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3-bis(ethylsulfanyl)propane is sourced from PubChem (CID 71445886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).