About (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane
(8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane (PubChem CID 71446280) has the molecular formula C28H23BrSi
and a molecular weight of 467.48 g/mol. Its IUPAC name is (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane.
Molecular Properties
| Compound Name | (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane |
| PubChem CID | 71446280 |
| Molecular Formula | C28H23BrSi |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane |
| SMILES | BrC1=CCCc2ccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C28H23BrSi/c29-28-18-10-11-22-19-20-26(21-27(22)28)30(23-12-4-1-5-13-23,24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-9,12-21H,10-11H2 |
| InChIKey | PYZBMCHYOXJRKO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane?
The IUPAC name of (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane (CID 71446280) is (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane.
What is the SMILES notation for (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane?
The canonical SMILES for (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane is BrC1=CCCc2ccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)cc21.
What is the InChIKey of (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane?
The InChIKey is PYZBMCHYOXJRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23BrSi/c29-28-18-10-11-22-19-20-26(21-27(22)28)30(23-12-4-1-5-13-23,24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-9,12-21H,10-11H2.
What are the key properties of (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane?
(8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane has a molecular weight of 467.48 g/mol, XLogP of 4.75, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (8-bromo-5,6-dihydronaphthalen-2-yl)-triphenylsilane is sourced from PubChem (CID 71446280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).