About 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene
1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene (PubChem CID 71446841) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene.
Analyze 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene?
The IUPAC name of 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene (CID 71446841) is 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene.
What is the SMILES notation for 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene?
The canonical SMILES for 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene is CC1=CC(C)=CC(C)=CC(C)=C1.
What is the InChIKey of 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene?
The InChIKey is XKORXPJTRSPQHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-9-5-10(2)7-12(4)8-11(3)6-9/h5-8H,1-4H3.
What are the key properties of 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene?
1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene has a molecular weight of 160.26 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5,7-tetramethylcycloocta-1,3,5,7-tetraene is sourced from PubChem (CID 71446841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).