About pentalene-1,5-dione
pentalene-1,5-dione (PubChem CID 71447096) has the molecular formula C8H4O2
and a molecular weight of 132.12 g/mol. Its IUPAC name is pentalene-1,5-dione.
Molecular Properties
| Compound Name | pentalene-1,5-dione |
| PubChem CID | 71447096 |
| Molecular Formula | C8H4O2 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | pentalene-1,5-dione |
| SMILES | O=c1cc2ccc(=O)c-2c1 |
| InChI | InChI=1S/C8H4O2/c9-6-3-5-1-2-8(10)7(5)4-6/h1-4H |
| InChIKey | AWXVRYCGEZPDSN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentalene-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentalene-1,5-dione?
The IUPAC name of pentalene-1,5-dione (CID 71447096) is pentalene-1,5-dione.
What is the SMILES notation for pentalene-1,5-dione?
The canonical SMILES for pentalene-1,5-dione is O=c1cc2ccc(=O)c-2c1.
What is the InChIKey of pentalene-1,5-dione?
The InChIKey is AWXVRYCGEZPDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O2/c9-6-3-5-1-2-8(10)7(5)4-6/h1-4H.
What are the key properties of pentalene-1,5-dione?
pentalene-1,5-dione has a molecular weight of 132.12 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentalene-1,5-dione is sourced from PubChem (CID 71447096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).