About 1-methylpyrrolidin-2-one;dihydrate
1-methylpyrrolidin-2-one;dihydrate (PubChem CID 71447185) has the molecular formula C5H13NO3
and a molecular weight of 135.16 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;dihydrate.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;dihydrate |
| PubChem CID | 71447185 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 1-methylpyrrolidin-2-one;dihydrate |
| SMILES | CN1CCCC1=O.O.O |
| InChI | InChI=1S/C5H9NO.2H2O/c1-6-4-2-3-5(6)7;;/h2-4H2,1H3;2*1H2 |
| InChIKey | UAGMFWLBFBJCHX-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methylpyrrolidin-2-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;dihydrate?
The IUPAC name of 1-methylpyrrolidin-2-one;dihydrate (CID 71447185) is 1-methylpyrrolidin-2-one;dihydrate.
What is the SMILES notation for 1-methylpyrrolidin-2-one;dihydrate?
The canonical SMILES for 1-methylpyrrolidin-2-one;dihydrate is CN1CCCC1=O.O.O.
What is the InChIKey of 1-methylpyrrolidin-2-one;dihydrate?
The InChIKey is UAGMFWLBFBJCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.2H2O/c1-6-4-2-3-5(6)7;;/h2-4H2,1H3;2*1H2.
What are the key properties of 1-methylpyrrolidin-2-one;dihydrate?
1-methylpyrrolidin-2-one;dihydrate has a molecular weight of 135.16 g/mol, XLogP of -1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;dihydrate is sourced from PubChem (CID 71447185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).