C20H30O — CID 71447340
1,7,7a-trimethyl-1-(4-methylpent-3-enyl)-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one (PubChem CID 71447340) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 1,7,7a-trimethyl-1-(4-methylpent-3-enyl)-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one.
| Compound Name | 1,7,7a-trimethyl-1-(4-methylpent-3-enyl)-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one |
|---|---|
| PubChem CID | 71447340 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1,7,7a-trimethyl-1-(4-methylpent-3-enyl)-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one |
| SMILES | CC(C)=CCCC1(C)C2C(=O)C=C3CCCC(C)C3(C)C21 |
| InChI | InChI=1S/C20H30O/c1-13(2)8-7-11-19(4)17-16(21)12-15-10-6-9-14(3)20(15,5)18(17)19/h8,12,14,17-18H,6-7,9-11H2,1-5H3 |
| InChIKey | UMWCYOSJOSAMFG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|