About 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine
6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine (PubChem CID 71448245) has the molecular formula C18H10F2N2O2
and a molecular weight of 324.29 g/mol. Its IUPAC name is 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine |
| PubChem CID | 71448245 |
| Molecular Formula | C18H10F2N2O2 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine |
| SMILES | Fc1cccc(F)c1Oc1ccc2c(-c3ccccc3)noc2n1 |
| InChI | InChI=1S/C18H10F2N2O2/c19-13-7-4-8-14(20)17(13)23-15-10-9-12-16(22-24-18(12)21-15)11-5-2-1-3-6-11/h1-10H |
| InChIKey | WNYHJVJDUJHCGY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine?
The IUPAC name of 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine (CID 71448245) is 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine.
What is the SMILES notation for 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine?
The canonical SMILES for 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine is Fc1cccc(F)c1Oc1ccc2c(-c3ccccc3)noc2n1.
What is the InChIKey of 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine?
The InChIKey is WNYHJVJDUJHCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F2N2O2/c19-13-7-4-8-14(20)17(13)23-15-10-9-12-16(22-24-18(12)21-15)11-5-2-1-3-6-11/h1-10H.
What are the key properties of 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine?
6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine has a molecular weight of 324.29 g/mol, XLogP of 4.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-difluorophenoxy)-3-phenyl-[1,2]oxazolo[5,4-b]pyridine is sourced from PubChem (CID 71448245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).