C18H22N6O3 — CID 71448450
N-(2-acetamidoethyl)-7-(2-methylbenzoyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide (PubChem CID 71448450) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-7-(2-methylbenzoyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-7-(2-methylbenzoyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 71448450 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(2-acetamidoethyl)-7-(2-methylbenzoyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1nnc2n1CCN(C(=O)c1ccccc1C)C2 |
| InChI | InChI=1S/C18H22N6O3/c1-12-5-3-4-6-14(12)18(27)23-9-10-24-15(11-23)21-22-16(24)17(26)20-8-7-19-13(2)25/h3-6H,7-11H2,1-2H3,(H,19,25)(H,20,26) |
| InChIKey | KMPYQIOQCKRIFR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|